CAS 1803571-59-6

Methyl 1H-pyrrolo[2,3-c]pyridine-3-acetate

Description:

Methyl 1H-pyrrolo[2,3-c]pyridine-3-acetate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine moieties. This compound typically exhibits a molecular formula that reflects its complex structure, featuring multiple functional groups, including an acetate group. It is often studied for its potential biological activities, particularly in medicinal chemistry, where derivatives of pyridine and pyrrole are known for their pharmacological properties. The compound may display moderate to high solubility in organic solvents, while its stability can be influenced by environmental factors such as temperature and pH. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a valuable intermediate in organic synthesis. Safety data sheets would provide essential information regarding its handling, storage, and potential hazards, emphasizing the importance of proper laboratory practices when working with this substance. Overall, Methyl 1H-pyrrolo[2,3-c]pyridine-3-acetate represents a significant compound in the field of organic chemistry and drug development.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1S/C10H10N2O2/c1-14-10(13)4-7-5-12-9-6-11-3-2-8(7)9/h2-3,5-6,12H,4H2,1H3

InChI key: InChIKey=PQEHPZOPPCIBMK-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C=1C=2C(NC1)=CN=CC2

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridine-3-acetic acid, methyl ester
• Methyl 1H-pyrrolo[2,3-c]pyridine-3-acetate

Methyl 2-{1H-pyrrolo[2,3-c]pyridin-3-yl}acetate

CAS: 1803571-59-6

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 190.2 g/mol

Ref: 3D-DXC57159