CAS 1803571-61-0

1-[5-(Difluoromethoxy)-4-fluoro-2-nitrophenyl]-1H-1,2,4-triazole

Description:

1-[5-(Difluoromethoxy)-4-fluoro-2-nitrophenyl]-1H-1,2,4-triazole is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a difluoromethoxy group and a nitrophenyl moiety, contributing to its potential biological activity and chemical reactivity. The presence of fluorine atoms often enhances the lipophilicity and metabolic stability of the compound, while the nitro group can influence its electronic properties and reactivity. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals. Its molecular structure suggests potential applications in various fields, including crop protection and disease management. As with many synthetic compounds, understanding its toxicity, environmental impact, and regulatory status is crucial for safe handling and application. Overall, this compound exemplifies the complexity and diversity of modern chemical entities used in research and industry.

Formula: C₉H₅F₃N₄O₃

InChI: InChI=1S/C9H5F3N4O3/c10-5-1-7(16(17)18)6(15-4-13-3-14-15)2-8(5)19-9(11)12/h1-4,9H

InChI key: InChIKey=LGYGQBVFSCXRMJ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=C(OC(F)F)C(F)=C1)N2C=NC=N2

Synonyms:

• 1-[5-(Difluoromethoxy)-4-fluoro-2-nitrophenyl]-1H-1,2,4-triazole
• 1H-1,2,4-Triazole, 1-[5-(difluoromethoxy)-4-fluoro-2-nitrophenyl]-

1-[5-(Difluoromethoxy)-4-fluoro-2-nitrophenyl]-1H-1,2,4-triazole

CAS: 1803571-61-0

Versatile small molecule scaffold

Formula: C₉H₅F₃N₄O₃

Purity: Min. 95%

Molecular weight: 274.16 g/mol

Ref: 3D-DXC57161