CAS 1803571-64-3

3-Morpholinecarboxylic acid, 4-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)

Description:

3-Morpholinecarboxylic acid, 4-(2,2,2-trifluoroethyl)-, hydrochloride (1:1) is a chemical compound characterized by its morpholine ring structure, which contributes to its potential biological activity. The presence of the trifluoroethyl group enhances its lipophilicity and may influence its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as being a weak acid due to the carboxylic acid functional group, and its hydrochloride form can stabilize the molecule, improving its stability and shelf-life. Additionally, the trifluoroethyl substituent can impart unique electronic properties, potentially affecting the compound's reactivity and pharmacokinetics. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields, where its specific interactions and effects can be further explored.

Formula: C₇H₁₀F₃NO₃·ClH

InChI: InChI=1S/C7H10F3NO3.ClH/c8-7(9,10)4-11-1-2-14-3-5(11)6(12)13;/h5H,1-4H2,(H,12,13);1H

InChI key: InChIKey=JUDNNDOSBDBMLG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1N(CC(F)(F)F)CCOC1.Cl

Synonyms:

• 3-Morpholinecarboxylic acid, 4-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)

4-(2,2,2-Trifluoroethyl)morpholine-3-carboxylic acid hydrochloride

CAS: 1803571-64-3

Versatile small molecule scaffold

Formula: C₇H₁₁ClF₃NO₃

Purity: Min. 95%

Molecular weight: 249.61 g/mol

Ref: 3D-DXC57164