CAS 1803571-74-5

Leucine, (1-methylethyl)-, hydrochloride (1:1)

Description:

Leucine, (1-methylethyl)-, hydrochloride (1:1), identified by CAS number 1803571-74-5, is a hydrochloride salt of the amino acid leucine, which is one of the essential branched-chain amino acids (BCAAs). This compound is characterized by its role in protein synthesis, muscle repair, and energy production. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability. Leucine is known for its hydrophobic nature due to its aliphatic side chain, which contributes to its structural role in proteins. The hydrochloride form can exhibit stability under various conditions, making it suitable for pharmaceutical and nutritional applications. In terms of safety, leucine is generally recognized as safe when consumed in appropriate amounts, although excessive intake may lead to metabolic imbalances. Its applications extend to dietary supplements, particularly for athletes and individuals seeking to support muscle growth and recovery. Overall, leucine hydrochloride is a vital compound in biochemistry and nutrition, reflecting the importance of amino acids in human health.

Formula: C₉H₁₉NO₂·ClH

InChI: InChI=1S/C9H19NO2.ClH/c1-5(2)7(6(3)4)8(10)9(11)12;/h5-8H,10H2,1-4H3,(H,11,12);1H

InChI key: InChIKey=BZVMTVNSNJQAQT-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)N)(C(C)C)C(C)C.Cl

Synonyms:

• Leucine, (1-methylethyl)-, hydrochloride (1:1)

2-Amino-4-methyl-3-(propan-2-yl)pentanoic acid hydrochloride

CAS: 1803571-74-5

Versatile small molecule scaffold

Formula: C₉H₂₀ClNO₂

Purity: Min. 95%

Molecular weight: 209.71 g/mol

Ref: 3D-DXC57174