CAS 1803580-68-8

2H-Pyran-3-amine, tetrahydro-2-(2-methylpropyl)-, hydrochloride (1:1)

Description:

2H-Pyran-3-amine, tetrahydro-2-(2-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This specific compound features a tetrahydro substitution, indicating that it has undergone hydrogenation, resulting in a saturated ring system. The presence of an amine group (-NH2) suggests that it can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The hydrochloride form indicates that the amine is protonated, enhancing its solubility in water and making it more stable in certain environments. The branched alkyl group (2-methylpropyl) contributes to its hydrophobic characteristics, potentially influencing its biological activity and interactions. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further studies and evaluations in biological systems.

Formula: C₉H₁₉NO·ClH

InChI: InChI=1S/C9H19NO.ClH/c1-7(2)6-9-8(10)4-3-5-11-9;/h7-9H,3-6,10H2,1-2H3;1H

InChI key: InChIKey=DMQAEGCNMYRAFJ-UHFFFAOYSA-N

SMILES: C(C(C)C)C1C(N)CCCO1.Cl

Synonyms:

• 2H-Pyran-3-amine, tetrahydro-2-(2-methylpropyl)-, hydrochloride (1:1)

2-(2-Methylpropyl)oxan-3-amine hydrochloride

CAS: 1803580-68-8

Versatile small molecule scaffold

Formula: C₉H₂₀ClNO

Purity: Min. 95%

Molecular weight: 193.71 g/mol

Ref: 3D-DXC58068