CAS 1803580-90-6

Ethanol, 2-[(2-aminoethyl)butylamino]-, hydrochloride (1:2)

Description:

Ethanol, 2-[(2-aminoethyl)butylamino]-, hydrochloride (1:2), with the CAS number 1803580-90-6, is a chemical compound that features both amino and alcohol functional groups, indicating its potential as a bioactive molecule. This compound is a hydrochloride salt, which typically enhances its solubility in water and stability. The presence of the aminoethyl and butylamino groups suggests that it may exhibit properties relevant to biological systems, such as acting as a ligand or influencing neurotransmitter activity. Ethanol, as a solvent, can facilitate the compound's interaction with various biological targets. The hydrochloride form often indicates that the compound is in a protonated state, which can affect its pharmacokinetics and bioavailability. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents or as a research tool in biochemical studies. However, specific applications and effects would require further investigation and characterization through empirical studies.

Formula: C₈H₂₀N₂O·2ClH

InChI: InChI=1S/C8H20N2O.2ClH/c1-2-3-5-10(6-4-9)7-8-11;;/h11H,2-9H2,1H3;2*1H

InChI key: InChIKey=JHMGKCDILDSRHT-UHFFFAOYSA-N

SMILES: N(CCCC)(CCN)CCO.Cl

Synonyms:

• Ethanol, 2-[(2-aminoethyl)butylamino]-, hydrochloride (1:2)

2-[(2-Aminoethyl)(butyl)amino]ethan-1-ol dihydrochloride

CAS: 1803580-90-6

Versatile small molecule scaffold

Formula: C₈H₂₂Cl₂N₂O

Purity: Min. 95%

Molecular weight: 233.18 g/mol

Ref: 3D-DXC58090