CAS 1803581-03-4

1,3-Diazaspiro[4.4]nonane-2,4-dione, 3-(2-aminoethyl)-, hydrochloride (1:1)

Description:

1,3-Diazaspiro[4.4]nonane-2,4-dione, 3-(2-aminoethyl)-, hydrochloride (1:1) is a chemical compound characterized by its spirocyclic structure, which includes two nitrogen atoms in a bicyclic framework. This compound features a diaza configuration, indicating the presence of two nitrogen atoms within the ring system, contributing to its unique chemical properties. The presence of a dione functional group suggests that it contains two carbonyl (C=O) groups, which can participate in various chemical reactions, including nucleophilic additions. The aminoethyl side chain enhances its potential for biological activity, possibly influencing its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound's specific characteristics, such as melting point, solubility, and reactivity, would depend on its molecular interactions and the presence of functional groups. Overall, this compound may have potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.

Formula: C₉H₁₅N₃O₂·ClH

InChI: InChI=1S/C9H15N3O2.ClH/c10-5-6-12-7(13)9(11-8(12)14)3-1-2-4-9;/h1-6,10H2,(H,11,14);1H

InChI key: InChIKey=XBTSQPARSREZFC-UHFFFAOYSA-N

SMILES: O=C1C2(NC(=O)N1CCN)CCCC2.Cl

Synonyms:

• 1,3-Diazaspiro[4.4]nonane-2,4-dione, 3-(2-aminoethyl)-, hydrochloride (1:1)

3-(2-Aminoethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione hydrochloride

CAS: 1803581-03-4

Versatile small molecule scaffold

Formula: C₉H₁₆ClN₃O₂

Purity: Min. 95%

Molecular weight: 233.69 g/mol

Ref: 3D-DXC58103