CAS 1803581-30-7

Spiro[3H-indole-3,4′-[4H]pyran], 1,2,2′,3′,5′,6′-hexahydro-, hydrochloride (1:1)

Description:

Spiro[3H-indole-3,4′-[4H]pyran], 1,2,2′,3′,5′,6′-hexahydro-, hydrochloride (1:1) is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both indole and pyran moieties. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and pharmacology. The presence of the hydrochloride salt form indicates enhanced solubility in aqueous environments, which is beneficial for biological assays and potential therapeutic applications. Its hexahydro configuration suggests a saturated framework that may influence its reactivity and interaction with biological targets. The compound's molecular structure likely contributes to its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). Additionally, the spiro arrangement can impart rigidity to the molecule, potentially affecting its binding affinity to various receptors or enzymes. Overall, this compound represents a fascinating area of study for researchers exploring novel therapeutic agents derived from complex organic structures.

Formula: C₁₂H₁₅NO·ClH

InChI: InChI=1S/C12H15NO.ClH/c1-2-4-11-10(3-1)12(9-13-11)5-7-14-8-6-12;/h1-4,13H,5-9H2;1H

InChI key: InChIKey=LZHOPFJQMLGBCB-UHFFFAOYSA-N

SMILES: C12(C=3C(NC1)=CC=CC3)CCOCC2.Cl

Synonyms:

• Spiro[3H-indole-3,4′-[4H]pyran], 1,2,2′,3′,5′,6′-hexahydro-, hydrochloride (1:1)
• 1,2-Dihydrospiro[indole-3,4′-oxane] hydrochloride

1,2-Dihydrospiro[indole-3,4'-oxane] hydrochloride

CAS: 1803581-30-7

Versatile small molecule scaffold

Formula: C₁₂H₁₆ClNO

Purity: Min. 95%

Molecular weight: 225.71 g/mol

Ref: 3D-DXC58130