CAS 1803581-35-2

Methyl 2-[3-(1,1-dimethylethoxy)cyclobutylidene]acetate

Description:

Methyl 2-[3-(1,1-dimethylethoxy)cyclobutylidene]acetate is an organic compound characterized by its unique structure, which includes a cyclobutylidene moiety and an ester functional group. This compound features a methyl ester group, which contributes to its reactivity and solubility in organic solvents. The presence of the 1,1-dimethylethoxy group enhances its steric bulk, potentially influencing its chemical behavior and interactions. Typically, compounds like this may exhibit properties such as moderate volatility and varying degrees of polarity, depending on the functional groups present. The cyclobutylidene structure may impart specific conformational characteristics, affecting its stability and reactivity in chemical reactions. Additionally, such compounds can be of interest in synthetic organic chemistry and may have applications in fields like pharmaceuticals or agrochemicals, where unique structural features can lead to specific biological activities or properties. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₁₁H₁₈O₃

InChI: InChI=1S/C11H18O3/c1-11(2,3)14-9-5-8(6-9)7-10(12)13-4/h7,9H,5-6H2,1-4H3

InChI key: InChIKey=NWASNEWRMVCMNR-UHFFFAOYSA-N

SMILES: O(C(C)(C)C)C1CC(=CC(OC)=O)C1

Synonyms:

• Acetic acid, 2-[3-(1,1-dimethylethoxy)cyclobutylidene]-, methyl ester
• Methyl 2-[3-(1,1-dimethylethoxy)cyclobutylidene]acetate

Methyl 2-[3-(tert-butoxy)cyclobutylidene]acetate

CAS: 1803581-35-2

Versatile small molecule scaffold

Formula: C₁₁H₁₈O₃

Purity: Min. 95%

Molecular weight: 198.26 g/mol

Ref: 3D-DXC58135