CAS 1803581-47-6

2,5-Pyridinediamine, N5-(hexahydro-1H-azepin-4-yl)-N2,N2-dimethyl-, hydrochloride (1:3)

Description:

2,5-Pyridinediamine, N5-(hexahydro-1H-azepin-4-yl)-N2,N2-dimethyl-, hydrochloride (1:3) is a chemical compound characterized by its complex structure, which includes a pyridine ring and a hexahydroazepine moiety. This compound features two amine functional groups, contributing to its potential as a ligand in coordination chemistry or as a building block in pharmaceutical synthesis. The hydrochloride salt form indicates that it is a protonated species, enhancing its solubility in water and making it suitable for various biological applications. The presence of dimethyl groups suggests steric hindrance, which may influence its reactivity and interaction with biological targets. As a compound with potential pharmacological properties, it may exhibit activities such as antimicrobial or anticancer effects, although specific biological data would be necessary to confirm these activities. Overall, its unique structural features and functional groups make it a compound of interest in medicinal chemistry and related fields.

Formula: C₁₃H₂₂N₄·3ClH

InChI: InChI=1S/C13H22N4.3ClH/c1-17(2)13-6-5-12(10-15-13)16-11-4-3-8-14-9-7-11;;;/h5-6,10-11,14,16H,3-4,7-9H2,1-2H3;3*1H

InChI key: InChIKey=YRFRHECKKOHIDL-UHFFFAOYSA-N

SMILES: N(C=1C=CC(N(C)C)=NC1)C2CCCNCC2.Cl

Synonyms:

• 2,5-Pyridinediamine, N5-(hexahydro-1H-azepin-4-yl)-N2,N2-dimethyl-, hydrochloride (1:3)

5-N-(Azepan-4-yl)-2-N,2-N-dimethylpyridine-2,5-diamine trihydrochloride

CAS: 1803581-47-6

Versatile small molecule scaffold

Formula: C₁₃H₂₅Cl₃N₄

Purity: Min. 95%

Molecular weight: 343.7 g/mol

Ref: 3D-DXC58147