CAS 1803581-51-2

2-Pyrimidinemethanamine, N-methyl-N-3-pyrrolidinyl-, hydrochloride (1:3)

Description:

2-Pyrimidinemethanamine, N-methyl-N-3-pyrrolidinyl-, hydrochloride (1:3) is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a pyrrolidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for various applications in medicinal chemistry and pharmacology. The presence of both amine and pyrrolidine functional groups suggests potential biological activity, possibly as a neurotransmitter modulator or in other therapeutic roles. The hydrochloride salt form enhances its stability and solubility, facilitating its use in pharmaceutical formulations. As with many compounds containing nitrogen heterocycles, it may exhibit basic properties, allowing it to interact with biological systems effectively. Safety and handling precautions are essential, as with any chemical substance, to mitigate potential hazards associated with its use. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications in drug development.

Formula: C₁₀H₁₆N₄·3ClH

InChI: InChI=1S/C10H16N4.3ClH/c1-14(9-3-6-11-7-9)8-10-12-4-2-5-13-10;;;/h2,4-5,9,11H,3,6-8H2,1H3;3*1H

InChI key: InChIKey=GNZMSPTXBOYQDA-UHFFFAOYSA-N

SMILES: N(CC=1N=CC=CN1)(C)C2CCNC2.Cl

Synonyms:

• 2-Pyrimidinemethanamine, N-methyl-N-3-pyrrolidinyl-, hydrochloride (1:3)

N-Methyl-N-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine trihydrochloride

CAS: 1803581-51-2

Versatile small molecule scaffold

Formula: C₁₀H₁₉Cl₃N₄

Purity: Min. 95%

Molecular weight: 301.6 g/mol

Ref: 3D-DXC58151