CAS 1803581-72-7

3(4H)-Quinazolineacetic acid, 2-methyl-4-oxo-, hydrochloride (1:1)

Description:

3(4H)-Quinazolineacetic acid, 2-methyl-4-oxo-, hydrochloride (1:1) is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features an acetic acid functional group, contributing to its acidic properties, and a methyl group at the 2-position, which influences its reactivity and solubility. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its stability and solubility in aqueous solutions. This compound may exhibit biological activity, potentially serving as a pharmacological agent, although specific biological properties would depend on further studies. Its molecular structure suggests potential interactions with various biological targets, making it of interest in medicinal chemistry. As with many quinazoline derivatives, it may also possess properties such as anti-inflammatory or anti-cancer activities, but detailed experimental data would be necessary to confirm these effects. Proper handling and safety measures should be observed due to its chemical nature.

Formula: C₁₁H₁₀N₂O₃·ClH

InChI: InChI=1S/C11H10N2O3.ClH/c1-7-12-9-5-3-2-4-8(9)11(16)13(7)6-10(14)15;/h2-5H,6H2,1H3,(H,14,15);1H

InChI key: InChIKey=APXOXPMPGGTOPC-UHFFFAOYSA-N

SMILES: O=C1C=2C(N=C(C)N1CC(O)=O)=CC=CC2.Cl

Synonyms:

• 3(4H)-Quinazolineacetic acid, 2-methyl-4-oxo-, hydrochloride (1:1)

2-(2-Methyl-4-oxo-3,4-dihydroquinazolin-3-yl)acetic acid hydrochloride

Controlled Product

CAS: 1803581-72-7

Versatile small molecule scaffold

Formula: C₁₁H₁₁ClN₂O₃

Purity: Min. 95%

Molecular weight: 254.67 g/mol

Ref: 3D-DXC58172