CAS 1803581-87-4

1H-1,2,4-Triazol-5-amine, N,N,3-trimethyl-, hydriodide (1:1)

Description:

1H-1,2,4-Triazol-5-amine, N,N,3-trimethyl-, hydriodide (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered aromatic ring containing three nitrogen atoms. This compound features a trimethylamino group, contributing to its basicity and potential for forming salts, as indicated by the hydriodide component. The presence of the hydriodide suggests that the compound is a salt formed from the protonation of the amine group, enhancing its solubility in polar solvents. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antifungal or antimicrobial agents. The compound's molecular structure allows for various interactions, including hydrogen bonding and coordination with metal ions, which can influence its reactivity and stability. Additionally, its properties may vary based on the specific conditions of use, such as pH and temperature, which can affect its solubility and biological activity. Overall, this compound represents a unique class of triazole derivatives with potential applications in medicinal chemistry.

Formula: C₅H₁₀N₄·HI

InChI: InChI=1S/C5H10N4.HI/c1-4-6-5(8-7-4)9(2)3;/h1-3H3,(H,6,7,8);1H

InChI key: InChIKey=BBVKCPFYEAOSSV-UHFFFAOYSA-N

SMILES: N(C)(C)C=1NC(C)=NN1.I

Synonyms:

• 1H-1,2,4-Triazol-5-amine, N,N,3-trimethyl-, hydriodide (1:1)

N,N,3-Trimethyl-1H-1,2,4-triazol-5-amine hydroiodide

CAS: 1803581-87-4

Versatile small molecule scaffold

Formula: C₅H₁₁IN₄

Purity: Min. 95%

Molecular weight: 254.07 g/mol

Ref: 3D-DXC58187