CAS 1803581-89-6

Pyridine, 1,2,3,6-tetrahydro-3,5-dimethyl-, hydrochloride (1:1)

Description:

Pyridine, 1,2,3,6-tetrahydro-3,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its cyclic structure, which includes a saturated pyridine ring with additional methyl groups. As a hydrochloride salt, it is typically encountered in a solid form, exhibiting good solubility in water due to the presence of the hydrochloride moiety. This compound is likely to possess basic properties, as it is derived from a nitrogen-containing heterocycle, which can accept protons. The presence of multiple methyl groups contributes to its hydrophobic character, influencing its reactivity and interactions with other substances. Pyridine derivatives are often utilized in organic synthesis, pharmaceuticals, and as solvents or reagents in various chemical reactions. Safety data should be consulted, as pyridine derivatives can exhibit toxicity and irritant properties. Overall, this compound's unique structure and properties make it of interest in both academic and industrial chemistry contexts.

Formula: C₇H₁₃N·ClH

InChI: InChI=1S/C7H13N.ClH/c1-6-3-7(2)5-8-4-6;/h3,6,8H,4-5H2,1-2H3;1H

InChI key: InChIKey=QWACEVANNOEHAJ-UHFFFAOYSA-N

SMILES: CC1C=C(C)CNC1.Cl

Synonyms:

• Pyridine, 1,2,3,6-tetrahydro-3,5-dimethyl-, hydrochloride (1:1)

3,5-Dimethyl-1,2,3,6-tetrahydropyridine hydrochloride

CAS: 1803581-89-6

Versatile small molecule scaffold

Formula: C₇H₁₄ClN

Purity: Min. 95%

Molecular weight: 147.64 g/mol

Ref: 3D-DXC58189