CAS 1803581-95-4

Piperidine, 4-(3-chlorophenyl)-4-fluoro-, hydrochloride (1:1)

Description:

Piperidine, 4-(3-chlorophenyl)-4-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 3-chlorophenyl group and a fluorine atom at the 4-position of the piperidine ring contributes to its unique chemical properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The presence of halogen substituents, such as chlorine and fluorine, often influences the compound's lipophilicity and reactivity, potentially affecting its pharmacokinetic properties. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₁₁H₁₃ClFN·ClH

InChI: InChI=1S/C11H13ClFN.ClH/c12-10-3-1-2-9(8-10)11(13)4-6-14-7-5-11;/h1-3,8,14H,4-7H2;1H

InChI key: InChIKey=MAILFXKITLJTGZ-UHFFFAOYSA-N

SMILES: FC1(C2=CC(Cl)=CC=C2)CCNCC1.Cl

Synonyms:

• Piperidine, 4-(3-chlorophenyl)-4-fluoro-, hydrochloride (1:1)

4-(3-CHLOROPHENYL)-4-FLUOROPIPERIDINE HCL

CAS: 1803581-95-4

Formula: C₁₁H₁₄Cl₂FN

Purity: 95.0%

Molecular weight: 250.14

Ref: 10-F537409

4-(3-Chlorophenyl)-4-fluoropiperidine hydrochloride

CAS: 1803581-95-4

Versatile small molecule scaffold

Formula: C₁₁H₁₄Cl₂FN

Purity: Min. 95%

Molecular weight: 250.14 g/mol

Ref: 3D-DXC58195