CAS 1803582-10-6

Pyrrolidine, 3-fluoro-3-(3-methoxyphenyl)-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-fluoro-3-(3-methoxyphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. The presence of a fluorine atom at the 3-position and a 3-methoxyphenyl group contributes to its unique properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. The methoxy group may also affect the compound's lipophilicity and interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₄FNO.ClH

InChI: InChI=1S/C11H14FNO.ClH/c1-14-10-4-2-3-9(7-10)11(12)5-6-13-8-11;/h2-4,7,13H,5-6,8H2,1H3;1H

InChI key: InChIKey=JQKODRYYPSMZFQ-UHFFFAOYSA-N

SMILES: FC1(CCNC1)C2=CC(OC)=CC=C2.Cl

3-Fluoro-3-(3-methoxyphenyl)pyrrolidine hydrochloride

CAS: 1803582-10-6

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClFNO

Purity: Min. 95%

Molecular weight: 231.69 g/mol

Ref: 3D-DXC58210