CAS 1803582-27-5

Pyridine, 2-(bromomethyl)-5-methoxy-, hydrochloride (1:1)

Description:

Pyridine, 2-(bromomethyl)-5-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a bromomethyl group and a methoxy group, which contribute to its reactivity and solubility properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its stability and solubility in water. Pyridine derivatives are often used in organic synthesis and medicinal chemistry due to their ability to act as bases and nucleophiles. The presence of the bromomethyl group suggests potential for further functionalization, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the methoxy group can influence the electronic properties of the compound, affecting its reactivity and interaction with biological systems. Overall, this compound's unique structural features make it of interest in various chemical research and application fields.

Formula: C₇H₈BrNO·ClH

InChI: InChI=1S/C7H8BrNO.ClH/c1-10-7-3-2-6(4-8)9-5-7;/h2-3,5H,4H2,1H3;1H

InChI key: InChIKey=AVFWMYUOYOWJBR-UHFFFAOYSA-N

SMILES: O(C)C=1C=CC(CBr)=NC1.Cl

Synonyms:

• Pyridine, 2-(bromomethyl)-5-methoxy-, hydrochloride (1:1)

2-(Bromomethyl)-5-methoxypyridine hydrochloride

CAS: 1803582-27-5

Versatile small molecule scaffold

Formula: C₇H₉BrClNO

Purity: Min. 95%

Molecular weight: 238.51 g/mol

Ref: 3D-DXC58227