CAS 1803582-49-1

2-Oxa-7-azaspiro[4.4]nonane-9-carboxylic acid, hydrochloride (1:1)

Description:

2-Oxa-7-azaspiro[4.4]nonane-9-carboxylic acid, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both an oxo and an azaspiro moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties, and is typically encountered in its hydrochloride salt form, enhancing its solubility in aqueous environments. The presence of nitrogen and oxygen atoms in its structure suggests potential for hydrogen bonding, which can influence its reactivity and interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific stereochemistry and spatial arrangement can significantly affect its biological activity and binding affinity to target receptors. As with many spiro compounds, it may also display unique conformational characteristics that could be relevant in drug design and development. Overall, 2-Oxa-7-azaspiro[4.4]nonane-9-carboxylic acid, hydrochloride is a complex molecule with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₈H₁₃NO₃·ClH

InChI: InChI=1S/C8H13NO3.ClH/c10-7(11)6-3-9-4-8(6)1-2-12-5-8;/h6,9H,1-5H2,(H,10,11);1H

InChI key: InChIKey=UANKVQPIWMXZGI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C2(CNC1)CCOC2.Cl

Synonyms:

• 2-Oxa-7-azaspiro[4.4]nonane-9-carboxylic acid hydrochloride
• 2-Oxa-7-azaspiro[4.4]nonane-9-carboxylic acid, hydrochloride (1:1)

2-Oxa-7-azaspiro[4.4]nonane-9-carboxylic acid hydrochloride

CAS: 1803582-49-1

Versatile small molecule scaffold

Formula: C₈H₁₄ClNO₃

Purity: Min. 95%

Molecular weight: 207.65 g/mol

Ref: 3D-DXC58249