CAS 1803582-60-6

1,2-Ethanediamine, N1-methyl-N1-[(tetrahydro-2-furanyl)methyl]-, hydrochloride (1:2)

Description:

1,2-Ethanediamine, N1-methyl-N1-[(tetrahydro-2-furanyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its amine functional groups, specifically a diamine structure with a methyl and a tetrahydro-2-furanyl substituent. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the tetrahydrofuran moiety suggests potential reactivity and interactions typical of cyclic ethers, while the amine groups may participate in hydrogen bonding and nucleophilic reactions. The compound's molecular structure indicates it may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 1803582-60-6, allows for precise identification in chemical databases. As with many amines, it may have a basic nature, and safety precautions should be observed when handling due to potential irritant properties. Overall, this compound's unique structure may lend itself to various applications in organic synthesis and medicinal chemistry.

Formula: C₈H₁₈N₂O·2ClH

InChI: InChI=1S/C8H18N2O.2ClH/c1-10(5-4-9)7-8-3-2-6-11-8;;/h8H,2-7,9H2,1H3;2*1H

InChI key: InChIKey=MDTTVQQXNJZWSJ-UHFFFAOYSA-N

SMILES: C(N(CCN)C)C1CCCO1.Cl

Synonyms:

• 1,2-Ethanediamine, N1-methyl-N1-[(tetrahydro-2-furanyl)methyl]-, hydrochloride (1:2)

(2-Aminoethyl)(methyl)(oxolan-2-ylmethyl)amine dihydrochloride

CAS: 1803582-60-6

Versatile small molecule scaffold

Formula: C₈H₂₀Cl₂N₂O

Purity: Min. 95%

Molecular weight: 231.16 g/mol

Ref: 3D-DXC58260