CAS 1803582-76-4

3-Pyrrolidinol, 1-[(4-amino-3-fluorophenyl)methyl]-, hydrochloride (1:2)

Description:

3-Pyrrolidinol, 1-[(4-amino-3-fluorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a 4-amino-3-fluorophenyl group indicates that the compound has both amino and fluorine substituents, which can influence its biological activity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential for pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in drug synthesis or having specific pharmacological effects, although detailed biological activity would require further investigation. The molecular structure suggests it may interact with biological targets, potentially influencing neurotransmitter systems or other pathways. Safety and handling precautions should be observed, as with any chemical substance, particularly those with biological activity.

Formula: C₁₁H₁₅FN₂O·2ClH

InChI: InChI=1S/C11H15FN2O.2ClH/c12-10-5-8(1-2-11(10)13)6-14-4-3-9(15)7-14;;/h1-2,5,9,15H,3-4,6-7,13H2;2*1H

InChI key: InChIKey=DUAGSMBXCWTKIK-UHFFFAOYSA-N

SMILES: C(C1=CC(F)=C(N)C=C1)N2CC(O)CC2.Cl

Synonyms:

• 3-Pyrrolidinol, 1-[(4-amino-3-fluorophenyl)methyl]-, hydrochloride (1:2)

1-[(4-Amino-3-fluorophenyl)methyl]pyrrolidin-3-ol dihydrochloride

CAS: 1803582-76-4

Versatile small molecule scaffold

Formula: C₁₁H₁₇Cl₂FN₂O

Purity: Min. 95%

Molecular weight: 283.17 g/mol

Ref: 3D-DXC58276