CAS 1803582-96-8

Cyclopropanecarboxamide, 1-amino-N-phenyl-, hydrochloride (1:1)

Description:

Cyclopropanecarboxamide, 1-amino-N-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane ring structure, which is a three-membered carbon ring that contributes to its unique reactivity and strain. The presence of an amide functional group indicates that it can participate in hydrogen bonding, influencing its solubility and boiling point. The phenyl group attached to the nitrogen atom enhances the compound's lipophilicity and may affect its biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound's molecular interactions and potential pharmacological properties are of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in research or industry.

Formula: C₁₀H₁₂N₂O·ClH

InChI: InChI=1S/C10H12N2O.ClH/c11-10(6-7-10)9(13)12-8-4-2-1-3-5-8;/h1-5H,6-7,11H2,(H,12,13);1H

InChI key: InChIKey=FNWLHDYCIGYXGK-UHFFFAOYSA-N

SMILES: C(NC1=CC=CC=C1)(=O)C2(N)CC2.Cl

Synonyms:

• Cyclopropanecarboxamide, 1-amino-N-phenyl-, hydrochloride (1:1)

1-Amino-N-phenylcyclopropane-1-carboxamide hydrochloride

CAS: 1803582-96-8

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 212.67 g/mol

Ref: 3D-DXC58296