CAS 1803583-01-8

Thiomorpholine, 2,2-diethyl-, 1,1-dioxide, hydrochloride (1:1)

Description:

Thiomorpholine, 2,2-diethyl-, 1,1-dioxide, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a thiomorpholine ring with two ethyl groups and a sulfone functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the thiomorpholine moiety suggests potential biological activity, as thiomorpholines are often explored for their pharmacological properties. The hydrochloride form indicates that the compound can exist as a stable, crystalline solid, which is advantageous for handling and storage. Additionally, the compound's molecular structure may impart specific reactivity patterns, making it useful in the development of new chemical entities or as an intermediate in synthetic pathways. As with any chemical substance, safety data sheets should be consulted for handling, storage, and disposal guidelines to ensure safe use in laboratory or industrial settings.

Formula: C₈H₁₇NO₂S·ClH

InChI: InChI=1S/C8H17NO2S.ClH/c1-3-8(4-2)7-9-5-6-12(8,10)11;/h9H,3-7H2,1-2H3;1H

InChI key: InChIKey=SLTGOUPPXZWOHM-UHFFFAOYSA-N

SMILES: C(C)C1(CC)S(=O)(=O)CCNC1.Cl

Synonyms:

• Thiomorpholine, 2,2-diethyl-, 1,1-dioxide, hydrochloride (1:1)

2,​2-​Diethyl-thiomorpholine 1,​1-​dioxide hydrochloride

CAS: 1803583-01-8

Versatile small molecule scaffold

Formula: C₈H₁₈ClNO₂S

Purity: Min. 95%

Molecular weight: 227.75 g/mol

Ref: 3D-DXC58301