CAS 1803583-52-9

N-[(3-Fluoro-5-methylphenyl)sulfonyl]glycine

Description:

N-[(3-Fluoro-5-methylphenyl)sulfonyl]glycine is an organic compound characterized by its sulfonamide functional group, which is linked to a glycine moiety. This compound features a fluorinated aromatic ring, specifically a 3-fluoro-5-methylphenyl group, contributing to its unique chemical properties. The presence of the sulfonyl group enhances its solubility in polar solvents and may influence its biological activity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the amino acid and sulfonamide functionalities. Additionally, the fluorine atom can enhance metabolic stability and alter the lipophilicity of the compound. As with many sulfonamides, this compound may exhibit antibacterial properties, although specific biological activity would need to be evaluated through experimental studies. Overall, N-[(3-Fluoro-5-methylphenyl)sulfonyl]glycine represents a versatile scaffold for further chemical modifications and potential therapeutic applications.

Formula: C₉H₁₀FNO₄S

InChI: InChI=1S/C9H10FNO4S/c1-6-2-7(10)4-8(3-6)16(14,15)11-5-9(12)13/h2-4,11H,5H2,1H3,(H,12,13)

InChI key: InChIKey=ITSFEUZCYRHVPD-UHFFFAOYSA-N

SMILES: S(NCC(O)=O)(=O)(=O)C1=CC(C)=CC(F)=C1

Synonyms:

• N-[(3-Fluoro-5-methylphenyl)sulfonyl]glycine
• Glycine, N-[(3-fluoro-5-methylphenyl)sulfonyl]-

2-(3-Fluoro-5-methylbenzenesulfonamido)acetic acid

CAS: 1803583-52-9

Versatile small molecule scaffold

Formula: C₉H₁₀FNO₄S

Purity: Min. 95%

Molecular weight: 247.25 g/mol

Ref: 3D-DXC58352