CAS 1803583-53-0

Carbamothioic acid, N,N-dimethyl-, O-(2-chloro-3-pyridinyl) ester

Description:

Carbamothioic acid, N,N-dimethyl-, O-(2-chloro-3-pyridinyl) ester is a chemical compound characterized by its unique functional groups and structural features. It contains a carbamothioic acid moiety, which is indicative of its potential as a thiol derivative, and features N,N-dimethyl substitution that can influence its reactivity and solubility. The presence of the O-(2-chloro-3-pyridinyl) ester group suggests that it may exhibit biological activity, particularly in relation to interactions with biological targets, given the pyridine ring's role in pharmacology. This compound may be of interest in medicinal chemistry and agrochemical applications due to its potential efficacy as a pesticide or herbicide. Its molecular structure likely contributes to its stability and reactivity, making it a candidate for further study in various chemical contexts. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of chlorine and sulfur in its structure, which can impart specific hazards.

Formula: C₈H₉ClN₂OS

InChI: InChI=1S/C8H9ClN2OS/c1-11(2)8(13)12-6-4-3-5-10-7(6)9/h3-5H,1-2H3

InChI key: InChIKey=LOCPBSVZDXGHPW-UHFFFAOYSA-N

SMILES: O(C(N(C)C)=S)C1=C(Cl)N=CC=C1

Synonyms:

• Carbamothioic acid, N,N-dimethyl-, O-(2-chloro-3-pyridinyl) ester
• 1-[(2-Chloropyridin-3-yl)oxy]-N,N-dimethylmethanethioamide

1-[(2-Chloropyridin-3-yl)oxy]-N,N-dimethylmethanethioamide

CAS: 1803583-53-0

Versatile small molecule scaffold

Formula: C₈H₉ClN₂OS

Purity: Min. 95%

Molecular weight: 216.69 g/mol

Ref: 3D-DXC58353