CAS 1803583-57-4

Pentanimidamide, 2-methyl-, hydrochloride (1:1)

Description:

Pentanimidamide, 2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the pentanimidamide structure suggests that it may exhibit properties related to amine reactivity and can participate in hydrogen bonding due to the amide group. This compound may be of interest in medicinal chemistry, potentially serving as a precursor or active ingredient in drug development. Its molecular structure likely influences its pharmacokinetics and pharmacodynamics, making it essential to study its interactions with biological systems. Additionally, the hydrochloride form can affect the stability and shelf-life of the compound, which is crucial for storage and formulation purposes. Overall, while specific biological activities and applications would require further investigation, the characteristics of this compound suggest it has potential relevance in chemical and pharmaceutical research.

Formula: C₆H₁₄N₂·ClH

InChI: InChI=1S/C6H14N2.ClH/c1-3-4-5(2)6(7)8;/h5H,3-4H2,1-2H3,(H3,7,8);1H

InChI key: InChIKey=RGAFQZDBOLXAPM-UHFFFAOYSA-N

SMILES: C(CCC)(C(=N)N)C.Cl

Synonyms:

• Pentanimidamide, 2-methyl-, hydrochloride (1:1)

2-Methylpentanimidamide hydrochloride

CAS: 1803583-57-4

Versatile small molecule scaffold

Formula: C₆H₁₅ClN₂

Purity: Min. 95%

Molecular weight: 150.65 g/mol

Ref: 3D-DXC58357