CAS 1803583-79-0

Pyrrolidine, 3-fluoro-3-[2-(trifluoromethoxy)phenyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-fluoro-3-[2-(trifluoromethoxy)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. The presence of a fluorine atom at the 3-position of the pyrrolidine ring and a trifluoromethoxy group attached to a phenyl ring significantly influences its chemical properties, including its reactivity and polarity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The trifluoromethoxy group contributes to the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. The compound's specific interactions, stability, and potential applications would depend on its molecular structure and the functional groups present, which can influence its pharmacokinetics and pharmacodynamics. Safety and handling precautions should be observed due to the presence of fluorinated groups, which can pose environmental and health risks.

Formula: C₁₁H₁₁F₄NO·ClH

InChI: InChI=1S/C11H11F4NO.ClH/c12-10(5-6-16-7-10)8-3-1-2-4-9(8)17-11(13,14)15;/h1-4,16H,5-7H2;1H

InChI key: InChIKey=XGEKXJSYRPQAHT-UHFFFAOYSA-N

SMILES: FC1(C2=C(OC(F)(F)F)C=CC=C2)CCNC1.Cl

Synonyms:

• Pyrrolidine, 3-fluoro-3-[2-(trifluoromethoxy)phenyl]-, hydrochloride (1:1)

3-Fluoro-3-[2-(trifluoromethoxy)phenyl]pyrrolidine hydrochloride

CAS: 1803583-79-0

Versatile small molecule scaffold

Formula: C₁₁H₁₂ClF₄NO

Purity: Min. 95%

Molecular weight: 285.66 g/mol

Ref: 3D-DXC58379