CAS 1803583-81-4

4-[(2,5-Dioxo-1-pyrrolidinyl)amino]benzoic acid

Description:

4-[(2,5-Dioxo-1-pyrrolidinyl)amino]benzoic acid, identified by its CAS number 1803583-81-4, is a chemical compound that features a benzoic acid moiety substituted with a pyrrolidine derivative. This compound typically exhibits characteristics such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of both carboxylic acid and amine functional groups. The dioxo-pyrrolidine structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which can influence its reactivity and interactions with biological systems. The presence of the amino group indicates potential for forming salts or participating in peptide bond formation, making it of interest in medicinal chemistry and drug design. Additionally, the compound may exhibit specific biological activities, which would require further investigation through pharmacological studies. Overall, its unique structural features position it as a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₁₁H₁₀N₂O₄

InChI: InChI=1S/C11H10N2O4/c14-9-5-6-10(15)13(9)12-8-3-1-7(2-4-8)11(16)17/h1-4,12H,5-6H2,(H,16,17)

InChI key: InChIKey=IIXHTTDWHJOQHB-UHFFFAOYSA-N

SMILES: N(N1C(=O)CCC1=O)C2=CC=C(C(O)=O)C=C2

Synonyms:

• Benzoic acid, 4-[(2,5-dioxo-1-pyrrolidinyl)amino]-
• 4-[(2,5-Dioxo-1-pyrrolidinyl)amino]benzoic acid

4-[(2,5-Dioxopyrrolidin-1-yl)amino]benzoic acid

CAS: 1803583-81-4

Versatile small molecule scaffold

Formula: C₁₁H₁₀N₂O₄

Purity: Min. 95%

Molecular weight: 234.21 g/mol

Ref: 3D-DXC58381