CAS 1803584-31-7

Benzenemethanamine, N-methoxy-α,2-dimethyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, N-methoxy-α,2-dimethyl-, hydrochloride (1:1), with the CAS number 1803584-31-7, is a chemical compound characterized by its amine functional group and a methoxy substituent. This compound features a benzene ring attached to a methanamine structure, which is further substituted with two methyl groups at the alpha and beta positions relative to the amine. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. Typically, such compounds may exhibit biological activity, potentially acting as intermediates in the synthesis of pharmaceuticals or agrochemicals. The presence of the methoxy group can influence the compound's electronic properties and reactivity. As with many amines, it may participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions should be observed, as amines can be irritants and may pose health risks if not managed properly.

Formula: C₁₀H₁₅NO·ClH

InChI: InChI=1S/C10H15NO.ClH/c1-8-6-4-5-7-10(8)9(2)11-12-3;/h4-7,9,11H,1-3H3;1H

InChI key: InChIKey=JTKKMCALENXFQA-UHFFFAOYSA-N

SMILES: C(NOC)(C)C1=C(C)C=CC=C1.Cl

Synonyms:

• Benzenemethanamine, N-methoxy-α,2-dimethyl-, hydrochloride (1:1)

Methoxy[1-(2-methylphenyl)ethyl]amine hydrochloride

CAS: 1803584-31-7

Versatile small molecule scaffold

Formula: C₁₀H₁₆ClNO

Purity: Min. 95%

Molecular weight: 201.69 g/mol

Ref: 3D-DXC58431