CAS 1803584-33-9

Propanoic acid, 2-[(4-aminophenyl)thio]-, hydrochloride (1:1)

Description:

Propanoic acid, 2-[(4-aminophenyl)thio]-, hydrochloride (1:1) is a chemical compound characterized by its propanoic acid backbone, which features a thioether functional group attached to a phenyl ring that carries an amino group. This structure imparts both acidic and basic properties to the molecule, allowing it to exist as a zwitterion in certain conditions. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, including pharmaceuticals. The presence of the amino group suggests potential for biological activity, possibly influencing interactions with biological targets. Additionally, the thioether linkage may contribute to the compound's stability and reactivity. Overall, this compound is of interest in medicinal chemistry and may be explored for its therapeutic potential, particularly in the context of drug design and development. Its specific properties, such as melting point, solubility, and reactivity, would need to be determined through experimental methods.

Formula: C₉H₁₁NO₂S·ClH

InChI: InChI=1S/C9H11NO2S.ClH/c1-6(9(11)12)13-8-4-2-7(10)3-5-8;/h2-6H,10H2,1H3,(H,11,12);1H

InChI key: InChIKey=NVBJTDTXZPWIBZ-UHFFFAOYSA-N

SMILES: S(C(C(O)=O)C)C1=CC=C(N)C=C1.Cl

Synonyms:

• Propanoic acid, 2-[(4-aminophenyl)thio]-, hydrochloride (1:1)

2-[(4-Aminophenyl)sulfanyl]propanoic acid hydrochloride

CAS: 1803584-33-9

Versatile small molecule scaffold

Formula: C₉H₁₂ClNO₂S

Purity: Min. 95%

Molecular weight: 233.72 g/mol

Ref: 3D-DXC58433