CAS 1803584-51-1

Morpholine, 2,4,6-trimethyl-, hydrochloride (1:1)

Description:

Morpholine, 2,4,6-trimethyl-, hydrochloride (1:1) is a chemical compound characterized by its morpholine structure, which is a six-membered heterocyclic amine containing one oxygen atom and five carbon atoms. The presence of three methyl groups at the 2, 4, and 6 positions of the morpholine ring enhances its steric and electronic properties, potentially influencing its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it useful in various applications, including pharmaceuticals and chemical synthesis. The compound may exhibit basic properties due to the nitrogen atom in the morpholine ring, allowing it to form salts with acids. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which it is studied. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards.

Formula: C₇H₁₅NO·ClH

InChI: InChI=1S/C7H15NO.ClH/c1-6-4-8(3)5-7(2)9-6;/h6-7H,4-5H2,1-3H3;1H

InChI key: InChIKey=KLQPLRFEKHCJOF-UHFFFAOYSA-N

SMILES: CC1CN(C)CC(C)O1.Cl

Synonyms:

• Morpholine, 2,4,6-trimethyl-, hydrochloride (1:1)

2,4,6-Trimethylmorpholine hydrochloride

CAS: 1803584-51-1

Versatile small molecule scaffold

Formula: C₇H₁₆ClNO

Purity: Min. 95%

Molecular weight: 165.66 g/mol

Ref: 3D-DXC58451