CAS 1803584-59-9

3-Furanethanimidic acid, tetrahydro-, methyl ester, hydrochloride (1:1)

Description:

3-Furanethanimidic acid, tetrahydro-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features an amide functional group, indicating its potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of the methyl ester group suggests that it may exhibit ester-like properties, such as being susceptible to hydrolysis under certain conditions. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability in pharmaceutical applications. The tetrahydro configuration indicates that the compound may possess a saturated structure, which can affect its stability and interaction with biological systems. Overall, this compound may have potential applications in medicinal chemistry, particularly in the development of therapeutic agents, due to its unique structural features and functional groups. However, specific biological activity and safety profiles would require further investigation through empirical studies.

Formula: C₇H₁₃NO₂·ClH

InChI: InChI=1S/C7H13NO2.ClH/c1-9-7(8)4-6-2-3-10-5-6;/h6,8H,2-5H2,1H3;1H

InChI key: InChIKey=BZXBGNWNVKWVJE-UHFFFAOYSA-N

SMILES: C(C(OC)=N)C1CCOC1.Cl

Synonyms:

• 3-Furanethanimidic acid, tetrahydro-, methyl ester, hydrochloride (1:1)

Methyl 2-(oxolan-3-yl)ethanecarboximidate hydrochloride

CAS: 1803584-59-9

Versatile small molecule scaffold

Formula: C₇H₁₄ClNO₂

Purity: Min. 95%

Molecular weight: 179.64 g/mol

Ref: 3D-DXC58459