CAS 1803584-68-0

1H-Pyrazole, 1-(4-methyl-3-nitrophenyl)-

Description:

1H-Pyrazole, 1-(4-methyl-3-nitrophenyl)- is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This specific derivative features a 4-methyl-3-nitrophenyl group attached to the pyrazole ring, contributing to its unique chemical properties. The presence of the nitro group introduces significant polarity and potential reactivity, while the methyl group can influence the compound's solubility and steric properties. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals. Additionally, the compound's CAS number, 1803584-68-0, allows for precise identification and retrieval of information in chemical databases. Overall, 1H-Pyrazole, 1-(4-methyl-3-nitrophenyl)- is a notable example of a substituted pyrazole that may possess interesting chemical and biological characteristics.

Formula: C₁₀H₉N₃O₂

InChI: InChI=1S/C10H9N3O2/c1-8-3-4-9(7-10(8)13(14)15)12-6-2-5-11-12/h2-7H,1H3

InChI key: InChIKey=FWVQFKYIHNLCFF-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(C=CC1C)N2C=CC=N2

Synonyms:

• 1H-Pyrazole, 1-(4-methyl-3-nitrophenyl)-

1-(4-Methyl-3-nitrophenyl)-1H-pyrazole

CAS: 1803584-68-0

Versatile small molecule scaffold

Formula: C₁₀H₉N₃O₂

Purity: Min. 95%

Molecular weight: 203.2 g/mol

Ref: 3D-DXC58468