CAS 1803584-70-4

4-Thiazolecarboxylic acid, 2-(2-aminoethyl)-, ethyl ester, hydrobromide (1:1)

Description:

4-Thiazolecarboxylic acid, 2-(2-aminoethyl)-, ethyl ester, hydrobromide (1:1) is a chemical compound characterized by its thiazole ring, which contributes to its heterocyclic nature. This compound features a carboxylic acid functional group and an ethyl ester moiety, indicating it has both acidic and ester functionalities. The presence of a 2-aminoethyl group suggests that it has potential for forming hydrogen bonds, which can influence its solubility and reactivity. As a hydrobromide salt, it is likely to be more soluble in polar solvents, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The thiazole structure is known for its biological activity, making this compound of interest in medicinal chemistry. Its molecular interactions may be influenced by the presence of the amino group, which can participate in various chemical reactions. Overall, this compound's unique structural features and functional groups suggest potential applications in drug development and other chemical research areas.

Formula: C₈H₁₂N₂O₂S·BrH

InChI: InChI=1S/C8H12N2O2S.BrH/c1-2-12-8(11)6-5-13-7(10-6)3-4-9;/h5H,2-4,9H2,1H3;1H

InChI key: InChIKey=AJNSSHVRUWCJNS-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N=C(CCN)SC1.Br

Synonyms:

• 4-Thiazolecarboxylic acid, 2-(2-aminoethyl)-, ethyl ester, hydrobromide (1:1)

Ethyl 2-(2-aminoethyl)-1,3-thiazole-4-carboxylate hydrobromide

CAS: 1803584-70-4

Versatile small molecule scaffold

Formula: C₈H₁₃BrN₂O₂S

Purity: Min. 95%

Molecular weight: 281.17 g/mol

Ref: 3D-DXC58470