CAS 1803584-82-8

1-Pyrrolidineacetic acid, 3,3-dimethyl-, hydrochloride (1:1)

Description:

1-Pyrrolidineacetic acid, 3,3-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the 3,3-dimethyl substituent on the pyrrolidine ring enhances its steric bulk, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and biochemistry. The hydrochloride form also facilitates easier handling and dosing in medicinal formulations. This compound may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its mechanisms of action and potential therapeutic uses. Overall, its unique structural features and salt form contribute to its relevance in chemical research and potential applications in drug development.

Formula: C₈H₁₅NO₂·ClH

InChI: InChI=1S/C8H15NO2.ClH/c1-8(2)3-4-9(6-8)5-7(10)11;/h3-6H2,1-2H3,(H,10,11);1H

InChI key: InChIKey=ORSDQENIRNVFDP-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1CC(C)(C)CC1.Cl

Synonyms:

• 1-Pyrrolidineacetic acid, 3,3-dimethyl-, hydrochloride (1:1)

2-(3,3-Dimethylpyrrolidin-1-yl)acetic acid hydrochloride

CAS: 1803584-82-8

Versatile small molecule scaffold

Formula: C₈H₁₆ClNO₂

Purity: Min. 95%

Molecular weight: 193.67 g/mol

Ref: 3D-DXC58482