CAS 1803584-83-9

Propanoic acid, 3-hydroxy-2-[(methylamino)methyl]-, hydrochloride (1:1)

Description:

Propanoic acid, 3-hydroxy-2-[(methylamino)methyl]-, hydrochloride (1:1), identified by the CAS number 1803584-83-9, is a chemical compound that features both carboxylic acid and amine functional groups, which contribute to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the hydroxyl group indicates potential for hydrogen bonding, which can influence its solubility and reactivity. This compound may exhibit biological activity due to its structural characteristics, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in various chemical reactions, including esterification and amide formation. Additionally, the methylamino group may impart specific pharmacological properties, potentially affecting its interaction with biological targets. Overall, this compound's characteristics make it a subject of interest for further research in both synthetic and medicinal chemistry contexts.

Formula: C₅H₁₁NO₃·ClH

InChI: InChI=1S/C5H11NO3.ClH/c1-6-2-4(3-7)5(8)9;/h4,6-7H,2-3H2,1H3,(H,8,9);1H

InChI key: InChIKey=BBLLBMGQTLRGNM-UHFFFAOYSA-N

SMILES: C(CNC)(C(O)=O)CO.Cl

Synonyms:

• Propanoic acid, 3-hydroxy-2-[(methylamino)methyl]-, hydrochloride (1:1)
• 3-Hydroxy-2-[(methylamino)methyl]propanoic acid hydrochloride

3-Hydroxy-2-[(methylamino)methyl]propanoic acid hydrochloride

CAS: 1803584-83-9

Versatile small molecule scaffold

Formula: C₅H₁₂ClNO₃

Purity: Min. 95%

Molecular weight: 169.61 g/mol

Ref: 3D-DXC58483