CAS 1803584-93-1

2H-Pyran-4-amine, tetrahydro-N-(3-phenoxypropyl)-, hydrochloride (1:1)

Description:

2H-Pyran-4-amine, tetrahydro-N-(3-phenoxypropyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyran ring and an amine functional group. The presence of the tetrahydro moiety indicates that the compound is saturated, contributing to its stability and solubility in various solvents. The phenoxypropyl substituent enhances its potential for biological activity, possibly influencing its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water than its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as moderate to high polarity due to the presence of both hydrophilic amine and hydrophobic phenoxy groups, affecting its pharmacokinetics and bioavailability. Its specific applications and biological activities would depend on further research, including studies on its efficacy and safety profiles in relevant biological systems. Overall, this compound represents a class of organic molecules with potential utility in medicinal chemistry and drug development.

Formula: C₁₄H₂₁NO₂.ClH

InChI: InChI=1S/C14H21NO2.ClH/c1-2-5-14(6-3-1)17-10-4-9-15-13-7-11-16-12-8-13;/h1-3,5-6,13,15H,4,7-12H2;1H

InChI key: InChIKey=FGLXQHZXNZHEIU-UHFFFAOYSA-N

SMILES: N(CCCOC1=CC=CC=C1)C2CCOCC2.Cl

N-(3-Phenoxypropyl)oxan-4-amine hydrochloride

CAS: 1803584-93-1

Versatile small molecule scaffold

Formula: C₁₄H₂₂ClNO₂

Purity: Min. 95%

Molecular weight: 271.78 g/mol

Ref: 3D-DXC58493