
CAS 1803585-22-9
:Cyclobutanamine, 2-(trifluoromethyl)-, hydrochloride (1:1)
Description:
Cyclobutanamine, 2-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclobutane ring structure, which is a four-membered saturated cyclic hydrocarbon. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit interesting reactivity due to the electron-withdrawing nature of the trifluoromethyl group, which can affect nucleophilicity and acidity. Additionally, the hydrochloride form can facilitate the transport and absorption of the compound in biological systems. Overall, this substance is of interest in medicinal chemistry and material science, where its unique structural features may contribute to the development of novel therapeutic agents or functional materials.
Formula:C5H8F3N.ClH
InChI:InChI=1S/C5H8F3N.ClH/c6-5(7,8)3-1-2-4(3)9;/h3-4H,1-2,9H2;1H
InChI key:InChIKey=YYYMJJAPNAKGEH-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1C(N)CC1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.