CAS 1803585-40-1

Imidazo[1,2-a]pyridine-3-carboxylic acid, 5,6,7,8-tetrahydro-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine-3-carboxylic acid, 5,6,7,8-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which incorporates a fused bicyclic system. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids, including potential acidity due to the carboxylic acid functional group. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which often enhances solubility in water and may influence its pharmacological properties. The tetrahydro configuration suggests the presence of saturated carbon atoms in the ring structure, which can affect the compound's reactivity and stability. This substance may be of interest in medicinal chemistry due to its structural features, which could impart biological activity, making it a candidate for further research in drug development. As with many heterocycles, it may exhibit a range of interactions with biological targets, potentially leading to therapeutic applications. However, specific biological activity and applications would require further investigation and validation through experimental studies.

Formula: C₈H₁₀N₂O₂·ClH

InChI: InChI=1S/C8H10N2O2.ClH/c11-8(12)6-5-9-7-3-1-2-4-10(6)7;/h5H,1-4H2,(H,11,12);1H

InChI key: InChIKey=PJFPLCWRJBWDFD-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(=NC1)CCCC2.Cl

Synonyms:

• Imidazo[1,2-a]pyridine-3-carboxylic acid, 5,6,7,8-tetrahydro-, hydrochloride (1:1)

5H,6H,7H,8H-Imidazo[1,2-a]pyridine-3-carboxylic acid hydrochloride

CAS: 1803585-40-1

Versatile small molecule scaffold

Formula: C₈H₁₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 202.64 g/mol

Ref: 3D-DXC58540