CAS 1803585-70-7

2-Oxa-6-azaspiro[3.4]octane-8-carboxylic acid, 8-fluoro-, ethyl ester, hydrochloride (1:1)

Description:

2-Oxa-6-azaspiro[3.4]octane-8-carboxylic acid, 8-fluoro-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both an oxazolidine and a piperidine-like moiety. This compound features a carboxylic acid functional group, which is esterified with an ethyl group, enhancing its solubility and reactivity. The presence of a fluorine atom at the 8-position contributes to its potential biological activity and lipophilicity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in aqueous environments, facilitating its use in pharmaceutical formulations. The compound's spiro structure may impart specific conformational properties, influencing its interaction with biological targets. Overall, this compound's unique structural features and functional groups suggest potential applications in drug development, particularly in areas requiring novel therapeutic agents. Further studies would be necessary to elucidate its pharmacological properties and mechanisms of action.

Formula: C₉H₁₄FNO₃·ClH

InChI: InChI=1S/C9H14FNO3.ClH/c1-2-14-7(12)9(10)4-11-3-8(9)5-13-6-8;/h11H,2-6H2,1H3;1H

InChI key: InChIKey=SMVNVGQDGFXPKG-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1(F)C2(COC2)CNC1.Cl

Synonyms:

• 2-Oxa-6-azaspiro[3.4]octane-8-carboxylic acid, 8-fluoro-, ethyl ester, hydrochloride (1:1)

Ethyl 8-fluoro-2-oxa-6-azaspiro[3.4]octane-8-carboxylate hydrochloride

CAS: 1803585-70-7

Versatile small molecule scaffold

Formula: C₉H₁₅ClFNO₃

Purity: Min. 95%

Molecular weight: 239.67 g/mol

Ref: 3D-DXC58570