CAS 1803585-85-4

1-Oxa-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylic acid, 8-(9H-fluoren-9-ylmethyl) 3-methyl ester

Description:

1-Oxa-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylic acid, 8-(9H-fluoren-9-ylmethyl) 3-methyl ester is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. The presence of the oxa and diaza groups indicates that the molecule contains both ether and amine functionalities, contributing to its potential reactivity and solubility in various solvents. The dicarboxylic acid moiety suggests that the compound can participate in acid-base reactions, while the ester functionality may allow for hydrolysis under certain conditions. The fluorenylmethyl group enhances the compound's hydrophobic character, potentially influencing its biological activity and interaction with other molecules. This compound may exhibit interesting properties such as fluorescence due to the fluorenyl moiety, making it suitable for applications in materials science or medicinal chemistry. Overall, its structural complexity and functional groups suggest a range of potential applications, although specific properties such as melting point, solubility, and reactivity would require empirical investigation.

Formula: C₂₄H₂₄N₂O₅

InChI: InChI=1S/C24H24N2O5/c1-29-22(27)21-14-24(31-25-21)10-12-26(13-11-24)23(28)30-15-20-18-8-4-2-6-16(18)17-7-3-5-9-19(17)20/h2-9,20H,10-15H2,1H3

InChI key: InChIKey=FNQVWUDSCQBCSK-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1CC2(ON1)CCN(C(OCC3C=4C(C=5C3=CC=CC5)=CC=CC4)=O)CC2

Synonyms:

• 8-(9H-Fluoren-9-ylmethyl) 3-methyl 1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylate
• 1-Oxa-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylic acid, 8-(9H-fluoren-9-ylmethyl) 3-methyl ester

8-(9H-Fluoren-9-ylmethyl) 3-methyl 1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylate

CAS: 1803585-85-4

Versatile small molecule scaffold

Formula: C₂₄H₂₄N₂O₅

Purity: Min. 95%

Molecular weight: 420.5 g/mol

Ref: 3D-DXC58585