CAS 1803586-29-9

4-Thiazoleacetic acid, 2-(4-morpholinyl)-, lithium salt (1:1)

Description:

4-Thiazoleacetic acid, 2-(4-morpholinyl)-, lithium salt (1:1) is a chemical compound characterized by its thiazole and morpholine functional groups. The thiazole ring contributes to its heterocyclic nature, which can influence its biological activity and solubility. The presence of the morpholine moiety enhances its potential for interaction with biological targets, possibly affecting its pharmacological properties. As a lithium salt, it is likely to exhibit increased solubility in polar solvents, which can be advantageous for various applications, including medicinal chemistry. The lithium ion may also play a role in stabilizing the compound and influencing its reactivity. This compound is of interest in research contexts, particularly in the fields of drug development and materials science, due to its unique structural features and potential therapeutic applications. However, specific details regarding its reactivity, stability, and biological effects would require further investigation through empirical studies.

Formula: C₉H₁₂N₂O₃S·Li

InChI: InChI=1S/C9H12N2O3S.Li/c12-8(13)5-7-6-15-9(10-7)11-1-3-14-4-2-11;/h6H,1-5H2,(H,12,13);

InChI key: InChIKey=LKWRMJOUIVGHDA-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1N=C(SC1)N2CCOCC2.[Li]

Synonyms:

• 4-Thiazoleacetic acid, 2-(4-morpholinyl)-, lithium salt (1:1)

2-[2-(morpholin-4-yl)-1,3-thiazol-4-yl]acetate lithium (I)

CAS: 1803586-29-9

Versatile small molecule scaffold

Formula: C₉H₁₁LiN₂O₃S

Purity: Min. 95%

Molecular weight: 234.2 g/mol

Ref: 3D-DXC58629