CAS 1803586-45-9

Piperidine, 3-(1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1)

Description:

Piperidine, 3-(1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of the 1,2,4-oxadiazole moiety introduces unique properties, including potential biological activity, as oxadiazoles are often associated with pharmacological effects. This compound exists as a hydrochloride salt, which enhances its solubility in water and may influence its stability and bioavailability. Typically, piperidine derivatives are known for their applications in medicinal chemistry, serving as intermediates in the synthesis of various pharmaceuticals. The specific structure of this compound suggests potential uses in research or therapeutic contexts, particularly in the development of new drugs. Its molecular interactions, including hydrogen bonding and dipole-dipole interactions, may play a significant role in its biological activity. As with many chemical substances, safety data and handling precautions should be observed, given the potential for toxicity or reactivity associated with its components.

Formula: C₇H₁₁N₃O·ClH

InChI: InChI=1S/C7H11N3O.ClH/c1-2-6(4-8-3-1)7-9-5-10-11-7;/h5-6,8H,1-4H2;1H

InChI key: InChIKey=DPOHBYQRNMINOE-UHFFFAOYSA-N

SMILES: C1(=NC=NO1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-(1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1)

3-(1,2,4-Oxadiazol-5-yl)piperidine hydrochloride

CAS: 1803586-45-9

Versatile small molecule scaffold

Formula: C₇H₁₂ClN₃O

Purity: Min. 95%

Molecular weight: 189.64 g/mol

Ref: 3D-DXC58645