CAS 1803586-68-6

Butanoic acid, 3-amino-2-hydroxy-, ethyl ester, hydrochloride (1:1)

Description:

Butanoic acid, 3-amino-2-hydroxy-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group, which is derived from butanoic acid. The presence of an amino group and a hydroxyl group indicates that this compound has both basic and acidic properties, making it amphoteric. The hydrochloride form suggests that it is a salt formed by the reaction of the amine with hydrochloric acid, enhancing its solubility in water and stability. This compound is likely to exhibit moderate polarity due to the presence of both hydrophilic (hydroxyl and amino) and hydrophobic (butanoic acid) components. Its molecular structure allows for potential interactions such as hydrogen bonding, which can influence its reactivity and biological activity. As an ester, it may also participate in hydrolysis reactions under certain conditions. Overall, this compound could have applications in pharmaceuticals or biochemistry, particularly in contexts where its unique functional groups can be utilized for specific interactions or modifications.

Formula: C₆H₁₃NO₃·ClH

InChI: InChI=1S/C6H13NO3.ClH/c1-3-10-6(9)5(8)4(2)7;/h4-5,8H,3,7H2,1-2H3;1H

InChI key: InChIKey=SAWOEFWTUQZCRV-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(C(C)N)O.Cl

Synonyms:

• Butanoic acid, 3-amino-2-hydroxy-, ethyl ester, hydrochloride (1:1)

Ethyl 3-amino-2-hydroxybutanoate hydrochloride

CAS: 1803586-68-6

Versatile small molecule scaffold

Formula: C₆H₁₄ClNO₃

Purity: Min. 95%

Molecular weight: 183.63 g/mol

Ref: 3D-DXC58668