CAS 1803586-79-9

3-Pyrrolidineethanamine, 1-(1-methylethyl)-, hydrochloride (1:2)

Description:

3-Pyrrolidineethanamine, 1-(1-methylethyl)-, hydrochloride (1:2), identified by its CAS number 1803586-79-9, is a chemical compound characterized by its amine functional group and a pyrrolidine ring. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The compound features a branched alkyl group, specifically isopropyl, which contributes to its steric properties and may influence its biological activity. As an amine, it can participate in various chemical reactions, including alkylation and acylation, and may serve as a building block in the synthesis of pharmaceuticals or other organic compounds. Its hydrochloride form indicates that it is a salt, which is often used to improve the handling and formulation of the compound in various applications. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its potential biological effects and reactivity.

Formula: C₉H₂₀N₂·2ClH

InChI: InChI=1S/C9H20N2.2ClH/c1-8(2)11-6-4-9(7-11)3-5-10;;/h8-9H,3-7,10H2,1-2H3;2*1H

InChI key: InChIKey=TVVXNDIQCWDQHT-UHFFFAOYSA-N

SMILES: C(C)(C)N1CC(CCN)CC1.Cl

Synonyms:

• 3-Pyrrolidineethanamine, 1-(1-methylethyl)-, hydrochloride (1:2)

2-[1-(Propan-2-yl)pyrrolidin-3-yl]ethan-1-amine dihydrochloride

CAS: 1803586-79-9

Versatile small molecule scaffold

Formula: C₉H₂₂Cl₂N₂

Purity: Min. 95%

Molecular weight: 229.19 g/mol

Ref: 3D-DXC58679