CAS 1803587-05-4

1-Propanone, 3-bromo-1-(4-methyl-1-piperazinyl)-, hydrobromide (1:1)

Description:

1-Propanone, 3-bromo-1-(4-methyl-1-piperazinyl)-, hydrobromide (1:1) is a chemical compound characterized by its molecular structure, which includes a propanone backbone substituted with a bromine atom and a 4-methyl-1-piperazinyl group. This compound is typically encountered as a hydrobromide salt, indicating that it is in a protonated form, which enhances its solubility in polar solvents like water. The presence of the piperazine moiety suggests potential biological activity, as piperazine derivatives are often explored for their pharmacological properties. The bromine substitution can influence the compound's reactivity and stability, making it of interest in synthetic organic chemistry. Additionally, the hydrobromide form may affect the compound's handling and storage conditions, as well as its interaction with other substances. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and related fields.

Formula: C₈H₁₅BrN₂O·BrH

InChI: InChI=1S/C8H15BrN2O.BrH/c1-10-4-6-11(7-5-10)8(12)2-3-9;/h2-7H2,1H3;1H

InChI key: InChIKey=OGBCRTVKDVQJIG-UHFFFAOYSA-N

SMILES: C(CCBr)(=O)N1CCN(C)CC1.Br

Synonyms:

• 1-Propanone, 3-bromo-1-(4-methyl-1-piperazinyl)-, hydrobromide (1:1)

3-Bromo-1-(4-methylpiperazin-1-yl)propan-1-one hydrobromide

CAS: 1803587-05-4

Versatile small molecule scaffold

Formula: C₈H₁₆Br₂N₂O

Purity: Min. 95%

Molecular weight: 316.03 g/mol

Ref: 3D-DXC58705