CAS 1803587-38-3

Benzenemethanamine, 3,4-dichloro-α-(2-methoxyethyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3,4-dichloro-α-(2-methoxyethyl)-, hydrochloride (1:1), with the CAS number 1803587-38-3, is a chemical compound characterized by its amine functional group and the presence of a dichlorobenzene moiety. This compound features a methoxyethyl side chain, which contributes to its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. The dichloro substitution on the benzene ring may influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The presence of the amine group suggests potential for hydrogen bonding and interaction with various biological systems. Overall, this compound may exhibit unique pharmacological properties, warranting further investigation for applications in drug development or other chemical applications. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with chlorinated aromatic compounds.

Formula: C₁₀H₁₃Cl₂NO·ClH

InChI: InChI=1S/C10H13Cl2NO.ClH/c1-14-5-4-10(13)7-2-3-8(11)9(12)6-7;/h2-3,6,10H,4-5,13H2,1H3;1H

InChI key: InChIKey=OAXBWDOISOVERG-UHFFFAOYSA-N

SMILES: C(CCOC)(N)C1=CC(Cl)=C(Cl)C=C1.Cl

Synonyms:

• 1-(3,4-Dichlorophenyl)-3-methoxypropan-1-amine hydrochloride
• Benzenemethanamine, 3,4-dichloro-α-(2-methoxyethyl)-, hydrochloride (1:1)

1-(3,4-Dichlorophenyl)-3-methoxypropan-1-amine hydrochloride

CAS: 1803587-38-3

Versatile small molecule scaffold

Formula: C₁₀H₁₄Cl₃NO

Purity: Min. 95%

Molecular weight: 270.6 g/mol

Ref: 3D-DXC58738