CAS 1803587-56-5

2H-1,4-Benzothiazin-6-amine, 4-(2,2-difluoroethyl)-3,4-dihydro-, hydrochloride (1:1)

Description:

2H-1,4-Benzothiazin-6-amine, 4-(2,2-difluoroethyl)-3,4-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzothiazine core. This compound features a difluoroethyl substituent, which contributes to its potential biological activity and pharmacological properties. The hydrochloride salt form indicates that it is a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in medicinal chemistry. The presence of the amine group suggests potential reactivity and interaction with biological targets, which may be relevant in drug development. The compound's specific properties, such as melting point, solubility, and stability, would depend on its molecular interactions and the environment in which it is used. As with many benzothiazine derivatives, it may exhibit interesting pharmacological activities, including antimicrobial or anticancer properties, warranting further investigation in the context of therapeutic applications.

Formula: C₁₀H₁₂F₂N₂S·ClH

InChI: InChI=1S/C10H12F2N2S.ClH/c11-10(12)6-14-3-4-15-9-2-1-7(13)5-8(9)14;/h1-2,5,10H,3-4,6,13H2;1H

InChI key: InChIKey=KYABTNLFNYASKX-UHFFFAOYSA-N

SMILES: C(C(F)F)N1C=2C(=CC=C(N)C2)SCC1.Cl

Synonyms:

• 2H-1,4-Benzothiazin-6-amine, 4-(2,2-difluoroethyl)-3,4-dihydro-, hydrochloride (1:1)

4-(2,2-Difluoroethyl)-3,4-dihydro-2H-1,4-benzothiazin-6-amine hydrochloride

CAS: 1803587-56-5

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClF₂N₂S

Purity: Min. 95%

Molecular weight: 266.74 g/mol

Ref: 3D-DXC58756