CAS 1803587-89-4

5-(5-Chloro-2-methoxyphenyl)-1H-1,2,3-triazole

Description:

5-(5-Chloro-2-methoxyphenyl)-1H-1,2,3-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a chloro-substituted phenyl group and a methoxy group, contributing to its unique chemical properties. The presence of the chloro group typically enhances the compound's reactivity and may influence its biological activity, while the methoxy group can affect solubility and lipophilicity. The triazole moiety is known for its applications in pharmaceuticals, particularly as antifungal and antimicrobial agents, due to its ability to interact with biological targets. Additionally, this compound may exhibit interesting properties such as stability under various conditions and potential for forming coordination complexes with metals. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in research related to medicinal chemistry and material science. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₉H₈ClN₃O

InChI: InChI=1S/C9H8ClN3O/c1-14-9-3-2-6(10)4-7(9)8-5-11-13-12-8/h2-5H,1H3,(H,11,12,13)

InChI key: InChIKey=FMMGPFVADFGYEK-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(Cl)C=C1)C2=CN=NN2

Synonyms:

• 5-(5-Chloro-2-methoxyphenyl)-1H-1,2,3-triazole
• 1H-1,2,3-Triazole, 5-(5-chloro-2-methoxyphenyl)-

4-(5-Chloro-2-methoxyphenyl)-1H-1,2,3-triazole

CAS: 1803587-89-4

Versatile small molecule scaffold

Formula: C₉H₈ClN₃O

Purity: Min. 95%

Molecular weight: 209.63 g/mol

Ref: 3D-DXC58789