CAS 1803588-02-4

Azetidine, 3-cyclobutyl-, hydrochloride (1:1)

Description:

Azetidine, 3-cyclobutyl-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the cyclobutyl group at the 3-position of the azetidine ring contributes to its unique properties, including potential steric effects and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, potentially influencing pharmacological effects. The hydrochloride form often stabilizes the compound and facilitates its handling and formulation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, azetidine, 3-cyclobutyl-, hydrochloride (1:1) represents a class of compounds that may have significant implications in drug development and synthetic chemistry.

Formula: C₇H₁₃N·ClH

InChI: InChI=1S/C7H13N.ClH/c1-2-6(3-1)7-4-8-5-7;/h6-8H,1-5H2;1H

InChI key: InChIKey=PXOKRIPCDSBVCZ-UHFFFAOYSA-N

SMILES: C1(CCC1)C2CNC2.Cl

Synonyms:

• Azetidine, 3-cyclobutyl-, hydrochloride (1:1)

3-Cyclobutylazetidine hydrochloride

CAS: 1803588-02-4

Versatile small molecule scaffold

Formula: C₇H₁₄ClN

Purity: Min. 95%

Molecular weight: 147.64 g/mol

Ref: 3D-DXC58802