CAS 1803588-06-8

Carbamic acid, N-cyclopropyl-, 2-piperidinylmethyl ester, hydrochloride (1:1)

Description:

Carbamic acid, N-cyclopropyl-, 2-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a carbamic acid moiety linked to a cyclopropyl group and a piperidinylmethyl ester. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in aqueous solutions, making it suitable for various applications in medicinal chemistry and pharmacology. The presence of the cyclopropyl group contributes to its potential biological activity, as this structural feature can influence the compound's interaction with biological targets. The piperidine ring is known for its role in enhancing the lipophilicity and overall pharmacokinetic properties of compounds. As a hydrochloride salt, it is likely to exhibit improved stability and ease of handling compared to its free base form. Overall, this compound may be of interest in the development of therapeutic agents, particularly in areas related to central nervous system activity or other pharmacological effects.

Formula: C₁₀H₁₈N₂O₂·ClH

InChI: InChI=1S/C10H18N2O2.ClH/c13-10(12-8-4-5-8)14-7-9-3-1-2-6-11-9;/h8-9,11H,1-7H2,(H,12,13);1H

InChI key: InChIKey=ASYIEKSQLIEPKD-UHFFFAOYSA-N

SMILES: N(C(OCC1CCCCN1)=O)C2CC2.Cl

Synonyms:

• Carbamic acid, N-cyclopropyl-, 2-piperidinylmethyl ester, hydrochloride (1:1)
• Piperidin-2-ylmethyl N-cyclopropylcarbamate hydrochloride

Piperidin-2-ylmethyl N-cyclopropylcarbamate hydrochloride

CAS: 1803588-06-8

Versatile small molecule scaffold

Formula: C₁₀H₁₉ClN₂O₂

Purity: Min. 95%

Molecular weight: 234.72 g/mol

Ref: 3D-DXC58806